C27H30N6O2 — CID 108741423
1-(4-pyrrolidin-1-ylphenyl)-4-(4-quinoxalin-2-ylpiperazine-1-carbonyl)pyrrolidin-2-one (PubChem CID 108741423) has the molecular formula C27H30N6O2 and a molecular weight of 470.58 g/mol. Its IUPAC name is 1-(4-pyrrolidin-1-ylphenyl)-4-(4-quinoxalin-2-ylpiperazine-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-(4-pyrrolidin-1-ylphenyl)-4-(4-quinoxalin-2-ylpiperazine-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 108741423 |
| Molecular Formula | C27H30N6O2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 1-(4-pyrrolidin-1-ylphenyl)-4-(4-quinoxalin-2-ylpiperazine-1-carbonyl)pyrrolidin-2-one |
| SMILES | O=C(C1CC(=O)N(c2ccc(N3CCCC3)cc2)C1)N1CCN(c2cnc3ccccc3n2)CC1 |
| InChI | InChI=1S/C27H30N6O2/c34-26-17-20(19-33(26)22-9-7-21(8-10-22)30-11-3-4-12-30)27(35)32-15-13-31(14-16-32)25-18-28-23-5-1-2-6-24(23)29-25/h1-2,5-10,18,20H,3-4,11-17,19H2 |
| InChIKey | RYONARRQUWDPTM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|