C21H25N4O2+ — CID 9254747
(4S)-1-(4-methylphenyl)-4-(4-pyridin-1-ium-4-ylpiperazine-1-carbonyl)pyrrolidin-2-one (PubChem CID 9254747) has the molecular formula C21H25N4O2+ and a molecular weight of 365.46 g/mol. Its IUPAC name is (4S)-1-(4-methylphenyl)-4-(4-pyridin-1-ium-4-ylpiperazine-1-carbonyl)pyrrolidin-2-one.
| Compound Name | (4S)-1-(4-methylphenyl)-4-(4-pyridin-1-ium-4-ylpiperazine-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 9254747 |
| Molecular Formula | C21H25N4O2+ |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (4S)-1-(4-methylphenyl)-4-(4-pyridin-1-ium-4-ylpiperazine-1-carbonyl)pyrrolidin-2-one |
| SMILES | Cc1ccc(N2C[C@@H](C(=O)N3CCN(c4cc[nH+]cc4)CC3)CC2=O)cc1 |
| InChI | InChI=1S/C21H24N4O2/c1-16-2-4-19(5-3-16)25-15-17(14-20(25)26)21(27)24-12-10-23(11-13-24)18-6-8-22-9-7-18/h2-9,17H,10-15H2,1H3/p+1/t17-/m0/s1 |
| InChIKey | HQBPNMMMTPAQDB-KRWDZBQOSA-O |
| XLogP | 1.51 |
| TPSA | 58.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |