C24H20ClNO3 — CID 9056799
(4-phenylphenyl) (3S)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 9056799) has the molecular formula C24H20ClNO3 and a molecular weight of 405.88 g/mol. Its IUPAC name is (4-phenylphenyl) (3S)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (4-phenylphenyl) (3S)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9056799 |
| Molecular Formula | C24H20ClNO3 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | (4-phenylphenyl) (3S)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | Cc1ccc(N2C[C@@H](C(=O)Oc3ccc(-c4ccccc4)cc3)CC2=O)cc1Cl |
| InChI | InChI=1S/C24H20ClNO3/c1-16-7-10-20(14-22(16)25)26-15-19(13-23(26)27)24(28)29-21-11-8-18(9-12-21)17-5-3-2-4-6-17/h2-12,14,19H,13,15H2,1H3/t19-/m0/s1 |
| InChIKey | OTNVATGUKKLAQN-IBGZPJMESA-N |
| XLogP | 5.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|