C19H18ClNO3 — CID 9057592
(3,4-dimethylphenyl) (3S)-1-(2-chlorophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 9057592) has the molecular formula C19H18ClNO3 and a molecular weight of 343.81 g/mol. Its IUPAC name is (3,4-dimethylphenyl) (3S)-1-(2-chlorophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (3,4-dimethylphenyl) (3S)-1-(2-chlorophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9057592 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (3,4-dimethylphenyl) (3S)-1-(2-chlorophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | Cc1ccc(OC(=O)[C@H]2CC(=O)N(c3ccccc3Cl)C2)cc1C |
| InChI | InChI=1S/C19H18ClNO3/c1-12-7-8-15(9-13(12)2)24-19(23)14-10-18(22)21(11-14)17-6-4-3-5-16(17)20/h3-9,14H,10-11H2,1-2H3/t14-/m0/s1 |
| InChIKey | GVJSPDSKEKTZRW-AWEZNQCLSA-N |
| XLogP | 3.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|