C20H21NO3 — CID 9056820
(3,4-dimethylphenyl) (3R)-1-benzyl-5-oxopyrrolidine-3-carboxylate (PubChem CID 9056820) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (3,4-dimethylphenyl) (3R)-1-benzyl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (3,4-dimethylphenyl) (3R)-1-benzyl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9056820 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (3,4-dimethylphenyl) (3R)-1-benzyl-5-oxopyrrolidine-3-carboxylate |
| SMILES | Cc1ccc(OC(=O)[C@@H]2CC(=O)N(Cc3ccccc3)C2)cc1C |
| InChI | InChI=1S/C20H21NO3/c1-14-8-9-18(10-15(14)2)24-20(23)17-11-19(22)21(13-17)12-16-6-4-3-5-7-16/h3-10,17H,11-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | NTCZOYCTVWNBQX-QGZVFWFLSA-N |
| XLogP | 3.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|