C22H24ClNO3 — CID 9056801
[2-[(2S)-butan-2-yl]phenyl] (3R)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 9056801) has the molecular formula C22H24ClNO3 and a molecular weight of 385.89 g/mol. Its IUPAC name is [2-[(2S)-butan-2-yl]phenyl] (3R)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-[(2S)-butan-2-yl]phenyl] (3R)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9056801 |
| Molecular Formula | C22H24ClNO3 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | [2-[(2S)-butan-2-yl]phenyl] (3R)-1-(3-chloro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CC[C@H](C)c1ccccc1OC(=O)[C@@H]1CC(=O)N(c2ccc(C)c(Cl)c2)C1 |
| InChI | InChI=1S/C22H24ClNO3/c1-4-14(2)18-7-5-6-8-20(18)27-22(26)16-11-21(25)24(13-16)17-10-9-15(3)19(23)12-17/h5-10,12,14,16H,4,11,13H2,1-3H3/t14-,16+/m0/s1 |
| InChIKey | FZGHRDMTYJWWCS-GOEBONIOSA-N |
| XLogP | 5.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|