C19H18ClNO4 — CID 26096521
(2-chlorophenyl) (3R)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 26096521) has the molecular formula C19H18ClNO4 and a molecular weight of 359.81 g/mol. Its IUPAC name is (2-chlorophenyl) (3R)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2-chlorophenyl) (3R)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 26096521 |
| Molecular Formula | C19H18ClNO4 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | (2-chlorophenyl) (3R)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCOc1ccc(N2C[C@H](C(=O)Oc3ccccc3Cl)CC2=O)cc1 |
| InChI | InChI=1S/C19H18ClNO4/c1-2-24-15-9-7-14(8-10-15)21-12-13(11-18(21)22)19(23)25-17-6-4-3-5-16(17)20/h3-10,13H,2,11-12H2,1H3/t13-/m1/s1 |
| InChIKey | XFCPNIJZVXPFNW-CYBMUJFWSA-N |
| XLogP | 3.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|