C18H16ClNO4 — CID 9056891
(2-chlorophenyl) (3R)-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 9056891) has the molecular formula C18H16ClNO4 and a molecular weight of 345.78 g/mol. Its IUPAC name is (2-chlorophenyl) (3R)-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2-chlorophenyl) (3R)-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9056891 |
| Molecular Formula | C18H16ClNO4 |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | (2-chlorophenyl) (3R)-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1cccc(N2C[C@H](C(=O)Oc3ccccc3Cl)CC2=O)c1 |
| InChI | InChI=1S/C18H16ClNO4/c1-23-14-6-4-5-13(10-14)20-11-12(9-17(20)21)18(22)24-16-8-3-2-7-15(16)19/h2-8,10,12H,9,11H2,1H3/t12-/m1/s1 |
| InChIKey | HUMBHVXTZDJDOP-GFCCVEGCSA-N |
| XLogP | 3.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|