C17H12Cl3NO3 — CID 9057636
(2-chlorophenyl) (3S)-1-(2,3-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 9057636) has the molecular formula C17H12Cl3NO3 and a molecular weight of 384.65 g/mol. Its IUPAC name is (2-chlorophenyl) (3S)-1-(2,3-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2-chlorophenyl) (3S)-1-(2,3-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9057636 |
| Molecular Formula | C17H12Cl3NO3 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | (2-chlorophenyl) (3S)-1-(2,3-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(Oc1ccccc1Cl)[C@H]1CC(=O)N(c2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C17H12Cl3NO3/c18-11-4-1-2-7-14(11)24-17(23)10-8-15(22)21(9-10)13-6-3-5-12(19)16(13)20/h1-7,10H,8-9H2/t10-/m0/s1 |
| InChIKey | NZNYTBXFDXUJNM-JTQLQIEISA-N |
| XLogP | 4.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|