C19H15ClN2O4 — CID 43059595
(4-cyano-2-methoxyphenyl) 1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 43059595) has the molecular formula C19H15ClN2O4 and a molecular weight of 370.79 g/mol. Its IUPAC name is (4-cyano-2-methoxyphenyl) 1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (4-cyano-2-methoxyphenyl) 1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 43059595 |
| Molecular Formula | C19H15ClN2O4 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | (4-cyano-2-methoxyphenyl) 1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1cc(C#N)ccc1OC(=O)C1CC(=O)N(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H15ClN2O4/c1-25-17-7-12(10-21)5-6-16(17)26-19(24)13-8-18(23)22(11-13)15-4-2-3-14(20)9-15/h2-7,9,13H,8,11H2,1H3 |
| InChIKey | YBEAIQDFTCZXFU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|