C22H22N2O6 — CID 55336371
(4-cyano-2-ethoxyphenyl) 1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 55336371) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is (4-cyano-2-ethoxyphenyl) 1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (4-cyano-2-ethoxyphenyl) 1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 55336371 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (4-cyano-2-ethoxyphenyl) 1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCOc1cc(C#N)ccc1OC(=O)C1CC(=O)N(c2ccc(OC)cc2OC)C1 |
| InChI | InChI=1S/C22H22N2O6/c1-4-29-20-9-14(12-23)5-8-18(20)30-22(26)15-10-21(25)24(13-15)17-7-6-16(27-2)11-19(17)28-3/h5-9,11,15H,4,10,13H2,1-3H3 |
| InChIKey | QRNOYJGAASONBR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 98.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|