C17H18N4O4 — CID 9351324
(3S)-N,N-bis(cyanomethyl)-1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 9351324) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is (3S)-N,N-bis(cyanomethyl)-1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N,N-bis(cyanomethyl)-1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 9351324 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (3S)-N,N-bis(cyanomethyl)-1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(N2C[C@@H](C(=O)N(CC#N)CC#N)CC2=O)c(OC)c1 |
| InChI | InChI=1S/C17H18N4O4/c1-24-13-3-4-14(15(10-13)25-2)21-11-12(9-16(21)22)17(23)20(7-5-18)8-6-19/h3-4,10,12H,7-9,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | AKYOUFUJDHLQKY-LBPRGKRZSA-N |
| XLogP | 0.93 |
| TPSA | 106.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|