C17H18N4O2 — CID 9391934
(3S)-N,N-bis(cyanomethyl)-1-(3,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 9391934) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is (3S)-N,N-bis(cyanomethyl)-1-(3,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N,N-bis(cyanomethyl)-1-(3,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 9391934 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (3S)-N,N-bis(cyanomethyl)-1-(3,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2C[C@@H](C(=O)N(CC#N)CC#N)CC2=O)cc1C |
| InChI | InChI=1S/C17H18N4O2/c1-12-3-4-15(9-13(12)2)21-11-14(10-16(21)22)17(23)20(7-5-18)8-6-19/h3-4,9,14H,7-8,10-11H2,1-2H3/t14-/m0/s1 |
| InChIKey | ITFISXWHKQOMHB-AWEZNQCLSA-N |
| XLogP | 1.53 |
| TPSA | 88.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|