C16H23N3O4 — CID 119500040
1-(2,4-dimethoxyphenyl)-N-[2-(methylamino)ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 119500040) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-N-[2-(methylamino)ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2,4-dimethoxyphenyl)-N-[2-(methylamino)ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 119500040 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-N-[2-(methylamino)ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CNCCNC(=O)C1CC(=O)N(c2ccc(OC)cc2OC)C1 |
| InChI | InChI=1S/C16H23N3O4/c1-17-6-7-18-16(21)11-8-15(20)19(10-11)13-5-4-12(22-2)9-14(13)23-3/h4-5,9,11,17H,6-8,10H2,1-3H3,(H,18,21) |
| InChIKey | HQEYPDMXLMZCNI-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|