C18H24N2O6 — CID 9317880
methyl 4-[[(3S)-1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]butanoate (PubChem CID 9317880) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is methyl 4-[[(3S)-1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[(3S)-1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 9317880 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | methyl 4-[[(3S)-1-(2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)[C@H]1CC(=O)N(c2ccc(OC)cc2OC)C1 |
| InChI | InChI=1S/C18H24N2O6/c1-24-13-6-7-14(15(10-13)25-2)20-11-12(9-16(20)21)18(23)19-8-4-5-17(22)26-3/h6-7,10,12H,4-5,8-9,11H2,1-3H3,(H,19,23)/t12-/m0/s1 |
| InChIKey | CPLHPXSPABOJEI-LBPRGKRZSA-N |
| XLogP | 1.13 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|