C20H32N3O4+ — CID 9396235
3-[[(3S)-1-(2,5-dimethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl-diethylazanium (PubChem CID 9396235) has the molecular formula C20H32N3O4+ and a molecular weight of 378.49 g/mol. Its IUPAC name is 3-[[(3S)-1-(2,5-dimethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl-diethylazanium.
| Compound Name | 3-[[(3S)-1-(2,5-dimethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl-diethylazanium |
|---|---|
| PubChem CID | 9396235 |
| Molecular Formula | C20H32N3O4+ |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 3-[[(3S)-1-(2,5-dimethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl-diethylazanium |
| SMILES | CC[NH+](CC)CCCNC(=O)[C@H]1CC(=O)N(c2cc(OC)ccc2OC)C1 |
| InChI | InChI=1S/C20H31N3O4/c1-5-22(6-2)11-7-10-21-20(25)15-12-19(24)23(14-15)17-13-16(26-3)8-9-18(17)27-4/h8-9,13,15H,5-7,10-12,14H2,1-4H3,(H,21,25)/p+1/t15-/m0/s1 |
| InChIKey | VAKNIMMGZHVRGQ-HNNXBMFYSA-O |
| XLogP | 0.49 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|