C18H27FN3O2+ — CID 7421023
diethyl-[3-[[(3S)-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl]azanium (PubChem CID 7421023) has the molecular formula C18H27FN3O2+ and a molecular weight of 336.43 g/mol. Its IUPAC name is diethyl-[3-[[(3S)-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl]azanium.
| Compound Name | diethyl-[3-[[(3S)-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 7421023 |
| Molecular Formula | C18H27FN3O2+ |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | diethyl-[3-[[(3S)-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]propyl]azanium |
| SMILES | CC[NH+](CC)CCCNC(=O)[C@H]1CC(=O)N(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H26FN3O2/c1-3-21(4-2)11-5-10-20-18(24)14-12-17(23)22(13-14)16-8-6-15(19)7-9-16/h6-9,14H,3-5,10-13H2,1-2H3,(H,20,24)/p+1/t14-/m0/s1 |
| InChIKey | YGMSZYARPFWMLX-AWEZNQCLSA-O |
| XLogP | 0.61 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|