C14H18FN3O4S — CID 39040356
(3R)-1-(4-fluorophenyl)-N-[2-(methanesulfonamido)ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 39040356) has the molecular formula C14H18FN3O4S and a molecular weight of 343.38 g/mol. Its IUPAC name is (3R)-1-(4-fluorophenyl)-N-[2-(methanesulfonamido)ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(4-fluorophenyl)-N-[2-(methanesulfonamido)ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 39040356 |
| Molecular Formula | C14H18FN3O4S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (3R)-1-(4-fluorophenyl)-N-[2-(methanesulfonamido)ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CS(=O)(=O)NCCNC(=O)[C@@H]1CC(=O)N(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C14H18FN3O4S/c1-23(21,22)17-7-6-16-14(20)10-8-13(19)18(9-10)12-4-2-11(15)3-5-12/h2-5,10,17H,6-9H2,1H3,(H,16,20)/t10-/m1/s1 |
| InChIKey | YNTADIADYKMBOQ-SNVBAGLBSA-N |
| XLogP | -0.16 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|