C12H11ClN2O4S — CID 168711463
1-(4-cyano-2-methoxyphenyl)-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168711463) has the molecular formula C12H11ClN2O4S and a molecular weight of 314.75 g/mol. Its IUPAC name is 1-(4-cyano-2-methoxyphenyl)-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-(4-cyano-2-methoxyphenyl)-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168711463 |
| Molecular Formula | C12H11ClN2O4S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 1-(4-cyano-2-methoxyphenyl)-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | COc1cc(C#N)ccc1N1CC(S(=O)(=O)Cl)CC1=O |
| InChI | InChI=1S/C12H11ClN2O4S/c1-19-11-4-8(6-14)2-3-10(11)15-7-9(5-12(15)16)20(13,17)18/h2-4,9H,5,7H2,1H3 |
| InChIKey | RZSDVYMLXAWBEJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |