C11H13ClN2O4S — CID 168717427
1-(5-chloro-2-methoxyphenyl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168717427) has the molecular formula C11H13ClN2O4S and a molecular weight of 304.75 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168717427 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | COc1ccc(Cl)cc1N1CC(S(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C11H13ClN2O4S/c1-18-10-3-2-7(12)4-9(10)14-6-8(5-11(14)15)19(13,16)17/h2-4,8H,5-6H2,1H3,(H2,13,16,17) |
| InChIKey | DLYSPNXYTBKSLD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |