C10H9F3N2O3S — CID 168718544
5-oxo-1-(2,3,4-trifluorophenyl)pyrrolidine-3-sulfonamide (PubChem CID 168718544) has the molecular formula C10H9F3N2O3S and a molecular weight of 294.25 g/mol. Its IUPAC name is 5-oxo-1-(2,3,4-trifluorophenyl)pyrrolidine-3-sulfonamide.
| Compound Name | 5-oxo-1-(2,3,4-trifluorophenyl)pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168718544 |
| Molecular Formula | C10H9F3N2O3S |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 5-oxo-1-(2,3,4-trifluorophenyl)pyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C10H9F3N2O3S/c11-6-1-2-7(10(13)9(6)12)15-4-5(3-8(15)16)19(14,17)18/h1-2,5H,3-4H2,(H2,14,17,18) |
| InChIKey | ZSCNXIVTKUHOLZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|