C12H10F3NO — CID 168685621
4-ethenyl-1-(2,3,4-trifluorophenyl)pyrrolidin-2-one (PubChem CID 168685621) has the molecular formula C12H10F3NO and a molecular weight of 241.21 g/mol. Its IUPAC name is 4-ethenyl-1-(2,3,4-trifluorophenyl)pyrrolidin-2-one.
| Compound Name | 4-ethenyl-1-(2,3,4-trifluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168685621 |
| Molecular Formula | C12H10F3NO |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 4-ethenyl-1-(2,3,4-trifluorophenyl)pyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C12H10F3NO/c1-2-7-5-10(17)16(6-7)9-4-3-8(13)11(14)12(9)15/h2-4,7H,1,5-6H2 |
| InChIKey | YQYBFMODBXZDMW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|