C12H10ClF2NO — CID 168685609
1-(5-chloro-2,4-difluorophenyl)-4-ethenylpyrrolidin-2-one (PubChem CID 168685609) has the molecular formula C12H10ClF2NO and a molecular weight of 257.67 g/mol. Its IUPAC name is 1-(5-chloro-2,4-difluorophenyl)-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-(5-chloro-2,4-difluorophenyl)-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168685609 |
| Molecular Formula | C12H10ClF2NO |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 1-(5-chloro-2,4-difluorophenyl)-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2cc(Cl)c(F)cc2F)C1 |
| InChI | InChI=1S/C12H10ClF2NO/c1-2-7-3-12(17)16(6-7)11-4-8(13)9(14)5-10(11)15/h2,4-5,7H,1,3,6H2 |
| InChIKey | FSANVTSFNTYNGV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|