C12H10Cl3NO — CID 168685589
4-ethenyl-1-(2,4,6-trichlorophenyl)pyrrolidin-2-one (PubChem CID 168685589) has the molecular formula C12H10Cl3NO and a molecular weight of 290.58 g/mol. Its IUPAC name is 4-ethenyl-1-(2,4,6-trichlorophenyl)pyrrolidin-2-one.
| Compound Name | 4-ethenyl-1-(2,4,6-trichlorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168685589 |
| Molecular Formula | C12H10Cl3NO |
| Molecular Weight | 290.58 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | 4-ethenyl-1-(2,4,6-trichlorophenyl)pyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2c(Cl)cc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C12H10Cl3NO/c1-2-7-3-11(17)16(6-7)12-9(14)4-8(13)5-10(12)15/h2,4-5,7H,1,3,6H2 |
| InChIKey | HFBBIOWZDFTRIE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|