C12H11ClN2O4 — CID 168685655
1-(5-chloro-2-hydroxy-4-nitrophenyl)-4-ethenylpyrrolidin-2-one (PubChem CID 168685655) has the molecular formula C12H11ClN2O4 and a molecular weight of 282.68 g/mol. Its IUPAC name is 1-(5-chloro-2-hydroxy-4-nitrophenyl)-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-(5-chloro-2-hydroxy-4-nitrophenyl)-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168685655 |
| Molecular Formula | C12H11ClN2O4 |
| Molecular Weight | 282.68 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 1-(5-chloro-2-hydroxy-4-nitrophenyl)-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2cc(Cl)c([N+](=O)[O-])cc2O)C1 |
| InChI | InChI=1S/C12H11ClN2O4/c1-2-7-3-12(17)14(6-7)10-4-8(13)9(15(18)19)5-11(10)16/h2,4-5,7,16H,1,3,6H2 |
| InChIKey | FMIVOECJOPSZLJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.68 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|