C13H13F2NO — CID 168684654
1-(2,5-difluoro-4-methylphenyl)-4-ethenylpyrrolidin-2-one (PubChem CID 168684654) has the molecular formula C13H13F2NO and a molecular weight of 237.25 g/mol. Its IUPAC name is 1-(2,5-difluoro-4-methylphenyl)-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-(2,5-difluoro-4-methylphenyl)-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168684654 |
| Molecular Formula | C13H13F2NO |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 1-(2,5-difluoro-4-methylphenyl)-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2cc(F)c(C)cc2F)C1 |
| InChI | InChI=1S/C13H13F2NO/c1-3-9-5-13(17)16(7-9)12-6-10(14)8(2)4-11(12)15/h3-4,6,9H,1,5,7H2,2H3 |
| InChIKey | VXLCSKLGHNOUOC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|