C15H19NO3 — CID 168684671
1-(4,5-dimethoxy-2-methylphenyl)-4-ethenylpyrrolidin-2-one (PubChem CID 168684671) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-methylphenyl)-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-(4,5-dimethoxy-2-methylphenyl)-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168684671 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1-(4,5-dimethoxy-2-methylphenyl)-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2cc(OC)c(OC)cc2C)C1 |
| InChI | InChI=1S/C15H19NO3/c1-5-11-7-15(17)16(9-11)12-8-14(19-4)13(18-3)6-10(12)2/h5-6,8,11H,1,7,9H2,2-4H3 |
| InChIKey | FZIZEZGVYIBNQM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|