C13H13Br2NO2 — CID 168684549
1-(2,4-dibromo-6-methoxyphenyl)-4-ethenylpyrrolidin-2-one (PubChem CID 168684549) has the molecular formula C13H13Br2NO2 and a molecular weight of 375.06 g/mol. Its IUPAC name is 1-(2,4-dibromo-6-methoxyphenyl)-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-(2,4-dibromo-6-methoxyphenyl)-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168684549 |
| Molecular Formula | C13H13Br2NO2 |
| Molecular Weight | 375.06 g/mol |
| Exact Mass | 372.93 |
| IUPAC Name | 1-(2,4-dibromo-6-methoxyphenyl)-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2c(Br)cc(Br)cc2OC)C1 |
| InChI | InChI=1S/C13H13Br2NO2/c1-3-8-4-12(17)16(7-8)13-10(15)5-9(14)6-11(13)18-2/h3,5-6,8H,1,4,7H2,2H3 |
| InChIKey | YQRTXWSBVBDNIN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.06 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|