C12H11Br2NO — CID 168685715
1-(2,5-dibromophenyl)-4-ethenylpyrrolidin-2-one (PubChem CID 168685715) has the molecular formula C12H11Br2NO and a molecular weight of 345.03 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-(2,5-dibromophenyl)-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168685715 |
| Molecular Formula | C12H11Br2NO |
| Molecular Weight | 345.03 g/mol |
| Exact Mass | 342.92 |
| IUPAC Name | 1-(2,5-dibromophenyl)-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2cc(Br)ccc2Br)C1 |
| InChI | InChI=1S/C12H11Br2NO/c1-2-8-5-12(16)15(7-8)11-6-9(13)3-4-10(11)14/h2-4,6,8H,1,5,7H2 |
| InChIKey | XDXPPVFXXKSGJO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.03 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|