C15H16BrNO3 — CID 168684142
ethyl 5-bromo-2-(4-ethenyl-2-oxopyrrolidin-1-yl)benzoate (PubChem CID 168684142) has the molecular formula C15H16BrNO3 and a molecular weight of 338.20 g/mol. Its IUPAC name is ethyl 5-bromo-2-(4-ethenyl-2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | ethyl 5-bromo-2-(4-ethenyl-2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 168684142 |
| Molecular Formula | C15H16BrNO3 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | ethyl 5-bromo-2-(4-ethenyl-2-oxopyrrolidin-1-yl)benzoate |
| SMILES | C=CC1CC(=O)N(c2ccc(Br)cc2C(=O)OCC)C1 |
| InChI | InChI=1S/C15H16BrNO3/c1-3-10-7-14(18)17(9-10)13-6-5-11(16)8-12(13)15(19)20-4-2/h3,5-6,8,10H,1,4,7,9H2,2H3 |
| InChIKey | YZKDFRPCAPAWHU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|