C14H16BrNO3S — CID 168669823
ethyl 5-bromo-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]benzoate (PubChem CID 168669823) has the molecular formula C14H16BrNO3S and a molecular weight of 358.26 g/mol. Its IUPAC name is ethyl 5-bromo-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 5-bromo-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 168669823 |
| Molecular Formula | C14H16BrNO3S |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | ethyl 5-bromo-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1cc(Br)ccc1N1CC(CS)CC1=O |
| InChI | InChI=1S/C14H16BrNO3S/c1-2-19-14(18)11-6-10(15)3-4-12(11)16-7-9(8-20)5-13(16)17/h3-4,6,9,20H,2,5,7-8H2,1H3 |
| InChIKey | LDRGBDRBGNNYQR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|