C13H16N2O2S — CID 168669971
N-methyl-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]benzamide (PubChem CID 168669971) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is N-methyl-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]benzamide.
| Compound Name | N-methyl-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 168669971 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-methyl-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]benzamide |
| SMILES | CNC(=O)c1ccccc1N1CC(CS)CC1=O |
| InChI | InChI=1S/C13H16N2O2S/c1-14-13(17)10-4-2-3-5-11(10)15-7-9(8-18)6-12(15)16/h2-5,9,18H,6-8H2,1H3,(H,14,17) |
| InChIKey | QYQBYPKIMWXAIE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|