C14H15BrN4O3 — CID 168656094
ethyl 2-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-5-bromobenzoate (PubChem CID 168656094) has the molecular formula C14H15BrN4O3 and a molecular weight of 367.20 g/mol. Its IUPAC name is ethyl 2-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-5-bromobenzoate.
| Compound Name | ethyl 2-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-5-bromobenzoate |
|---|---|
| PubChem CID | 168656094 |
| Molecular Formula | C14H15BrN4O3 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | ethyl 2-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-5-bromobenzoate |
| SMILES | CCOC(=O)c1cc(Br)ccc1N1CC(CN=[N+]=[N-])CC1=O |
| InChI | InChI=1S/C14H15BrN4O3/c1-2-22-14(21)11-6-10(15)3-4-12(11)19-8-9(5-13(19)20)7-17-18-16/h3-4,6,9H,2,5,7-8H2,1H3 |
| InChIKey | PSBNYKQJJWYGAD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|