C12H14BrN5O — CID 168656251
4-(azidomethyl)-1-[4-bromo-2-(methylamino)phenyl]pyrrolidin-2-one (PubChem CID 168656251) has the molecular formula C12H14BrN5O and a molecular weight of 324.18 g/mol. Its IUPAC name is 4-(azidomethyl)-1-[4-bromo-2-(methylamino)phenyl]pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-[4-bromo-2-(methylamino)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168656251 |
| Molecular Formula | C12H14BrN5O |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 4-(azidomethyl)-1-[4-bromo-2-(methylamino)phenyl]pyrrolidin-2-one |
| SMILES | CNc1cc(Br)ccc1N1CC(CN=[N+]=[N-])CC1=O |
| InChI | InChI=1S/C12H14BrN5O/c1-15-10-5-9(13)2-3-11(10)18-7-8(4-12(18)19)6-16-17-14/h2-3,5,8,15H,4,6-7H2,1H3 |
| InChIKey | FGTHCBKEXQXOSH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|