C12H12Br2N4O2 — CID 168656397
4-(azidomethyl)-1-(2,4-dibromo-5-methoxyphenyl)pyrrolidin-2-one (PubChem CID 168656397) has the molecular formula C12H12Br2N4O2 and a molecular weight of 404.06 g/mol. Its IUPAC name is 4-(azidomethyl)-1-(2,4-dibromo-5-methoxyphenyl)pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-(2,4-dibromo-5-methoxyphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168656397 |
| Molecular Formula | C12H12Br2N4O2 |
| Molecular Weight | 404.06 g/mol |
| Exact Mass | 401.93 |
| IUPAC Name | 4-(azidomethyl)-1-(2,4-dibromo-5-methoxyphenyl)pyrrolidin-2-one |
| SMILES | COc1cc(N2CC(CN=[N+]=[N-])CC2=O)c(Br)cc1Br |
| InChI | InChI=1S/C12H12Br2N4O2/c1-20-11-4-10(8(13)3-9(11)14)18-6-7(2-12(18)19)5-16-17-15/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | OJDVPPXOEOQXSO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.06 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|