C12H12Br2N2O3 — CID 168696507
1-(2,4-dibromo-5-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 168696507) has the molecular formula C12H12Br2N2O3 and a molecular weight of 392.05 g/mol. Its IUPAC name is 1-(2,4-dibromo-5-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2,4-dibromo-5-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168696507 |
| Molecular Formula | C12H12Br2N2O3 |
| Molecular Weight | 392.05 g/mol |
| Exact Mass | 389.92 |
| IUPAC Name | 1-(2,4-dibromo-5-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1cc(N2CC(C(N)=O)CC2=O)c(Br)cc1Br |
| InChI | InChI=1S/C12H12Br2N2O3/c1-19-10-4-9(7(13)3-8(10)14)16-5-6(12(15)18)2-11(16)17/h3-4,6H,2,5H2,1H3,(H2,15,18) |
| InChIKey | JLCOGISFLFVSTK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.05 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |