C11H9BrF2N2O2 — CID 168697577
1-(4-bromo-2,5-difluorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 168697577) has the molecular formula C11H9BrF2N2O2 and a molecular weight of 319.11 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-bromo-2,5-difluorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168697577 |
| Molecular Formula | C11H9BrF2N2O2 |
| Molecular Weight | 319.11 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 1-(4-bromo-2,5-difluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CC(=O)N(c2cc(F)c(Br)cc2F)C1 |
| InChI | InChI=1S/C11H9BrF2N2O2/c12-6-2-8(14)9(3-7(6)13)16-4-5(11(15)18)1-10(16)17/h2-3,5H,1,4H2,(H2,15,18) |
| InChIKey | GRPCWYGMVOFUIS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.11 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|