C11H10BrF2NOS — CID 168671293
1-(4-bromo-2,5-difluorophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168671293) has the molecular formula C11H10BrF2NOS and a molecular weight of 322.17 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluorophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(4-bromo-2,5-difluorophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168671293 |
| Molecular Formula | C11H10BrF2NOS |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 1-(4-bromo-2,5-difluorophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C11H10BrF2NOS/c12-7-2-9(14)10(3-8(7)13)15-4-6(5-17)1-11(15)16/h2-3,6,17H,1,4-5H2 |
| InChIKey | ZKJMYNLTGCNCQI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|