C11H12BrFN2OS — CID 168671324
1-(2-amino-5-bromo-4-fluorophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168671324) has the molecular formula C11H12BrFN2OS and a molecular weight of 319.20 g/mol. Its IUPAC name is 1-(2-amino-5-bromo-4-fluorophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(2-amino-5-bromo-4-fluorophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168671324 |
| Molecular Formula | C11H12BrFN2OS |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 1-(2-amino-5-bromo-4-fluorophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | Nc1cc(F)c(Br)cc1N1CC(CS)CC1=O |
| InChI | InChI=1S/C11H12BrFN2OS/c12-7-2-10(9(14)3-8(7)13)15-4-6(5-17)1-11(15)16/h2-3,6,17H,1,4-5,14H2 |
| InChIKey | XGZDKBWNUIHANC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|