C11H10Cl2FNOS — CID 168671264
1-(2,4-dichloro-5-fluorophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168671264) has the molecular formula C11H10Cl2FNOS and a molecular weight of 294.18 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168671264 |
| Molecular Formula | C11H10Cl2FNOS |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl2FNOS/c12-7-2-8(13)10(3-9(7)14)15-4-6(5-17)1-11(15)16/h2-3,6,17H,1,4-5H2 |
| InChIKey | KSOSXIIBKHEXKB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|