C10H8ClF2NOS — CID 168709794
1-(2-chloro-4,5-difluorophenyl)-4-sulfanylpyrrolidin-2-one (PubChem CID 168709794) has the molecular formula C10H8ClF2NOS and a molecular weight of 263.70 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168709794 |
| Molecular Formula | C10H8ClF2NOS |
| Molecular Weight | 263.70 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-4-sulfanylpyrrolidin-2-one |
| SMILES | O=C1CC(S)CN1c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C10H8ClF2NOS/c11-6-2-7(12)8(13)3-9(6)14-4-5(16)1-10(14)15/h2-3,5,16H,1,4H2 |
| InChIKey | XWTBFZYLRRIFEV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.70 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|