C10H7F4NOS — CID 168709690
4-sulfanyl-1-(2,3,5,6-tetrafluorophenyl)pyrrolidin-2-one (PubChem CID 168709690) has the molecular formula C10H7F4NOS and a molecular weight of 265.23 g/mol. Its IUPAC name is 4-sulfanyl-1-(2,3,5,6-tetrafluorophenyl)pyrrolidin-2-one.
| Compound Name | 4-sulfanyl-1-(2,3,5,6-tetrafluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168709690 |
| Molecular Formula | C10H7F4NOS |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 4-sulfanyl-1-(2,3,5,6-tetrafluorophenyl)pyrrolidin-2-one |
| SMILES | O=C1CC(S)CN1c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C10H7F4NOS/c11-5-2-6(12)9(14)10(8(5)13)15-3-4(17)1-7(15)16/h2,4,17H,1,3H2 |
| InChIKey | JSBFNROPIPKPPC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|