C9H8Br2N2OS — CID 168710389
1-(2,6-dibromo-4-pyridinyl)-4-sulfanylpyrrolidin-2-one (PubChem CID 168710389) has the molecular formula C9H8Br2N2OS and a molecular weight of 352.05 g/mol. Its IUPAC name is 1-(2,6-dibromo-4-pyridinyl)-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-(2,6-dibromo-4-pyridinyl)-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168710389 |
| Molecular Formula | C9H8Br2N2OS |
| Molecular Weight | 352.05 g/mol |
| Exact Mass | 349.87 |
| IUPAC Name | 1-(2,6-dibromo-4-pyridinyl)-4-sulfanylpyrrolidin-2-one |
| SMILES | O=C1CC(S)CN1c1cc(Br)nc(Br)c1 |
| InChI | InChI=1S/C9H8Br2N2OS/c10-7-1-5(2-8(11)12-7)13-4-6(15)3-9(13)14/h1-2,6,15H,3-4H2 |
| InChIKey | VJVWICJZBZUFCB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 33.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.05 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|