C12H11NO5S — CID 168710407
5-(2-oxo-4-sulfanylpyrrolidin-1-yl)benzene-1,3-dicarboxylic acid (PubChem CID 168710407) has the molecular formula C12H11NO5S and a molecular weight of 281.29 g/mol. Its IUPAC name is 5-(2-oxo-4-sulfanylpyrrolidin-1-yl)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(2-oxo-4-sulfanylpyrrolidin-1-yl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 168710407 |
| Molecular Formula | C12H11NO5S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 5-(2-oxo-4-sulfanylpyrrolidin-1-yl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(N2CC(S)CC2=O)c1 |
| InChI | InChI=1S/C12H11NO5S/c14-10-4-9(19)5-13(10)8-2-6(11(15)16)1-7(3-8)12(17)18/h1-3,9,19H,4-5H2,(H,15,16)(H,17,18) |
| InChIKey | HVSXTOKTMNIEAT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|