C12H12ClNO4 — CID 168509328
3-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-hydroxybenzoic acid (PubChem CID 168509328) has the molecular formula C12H12ClNO4 and a molecular weight of 269.68 g/mol. Its IUPAC name is 3-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-hydroxybenzoic acid.
| Compound Name | 3-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 168509328 |
| Molecular Formula | C12H12ClNO4 |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 3-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)cc(N2CC(CCl)CC2=O)c1 |
| InChI | InChI=1S/C12H12ClNO4/c13-5-7-1-11(16)14(6-7)9-2-8(12(17)18)3-10(15)4-9/h2-4,7,15H,1,5-6H2,(H,17,18) |
| InChIKey | NJNRJFLDIHENPA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|