C12H10Br2ClNO3 — CID 168508534
3,5-dibromo-4-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]benzoic acid (PubChem CID 168508534) has the molecular formula C12H10Br2ClNO3 and a molecular weight of 411.48 g/mol. Its IUPAC name is 3,5-dibromo-4-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 3,5-dibromo-4-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 168508534 |
| Molecular Formula | C12H10Br2ClNO3 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 408.87 |
| IUPAC Name | 3,5-dibromo-4-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]benzoic acid |
| SMILES | O=C(O)c1cc(Br)c(N2CC(CCl)CC2=O)c(Br)c1 |
| InChI | InChI=1S/C12H10Br2ClNO3/c13-8-2-7(12(18)19)3-9(14)11(8)16-5-6(4-15)1-10(16)17/h2-3,6H,1,4-5H2,(H,18,19) |
| InChIKey | YYYUXCFUYUJEPW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|