C13H13BrClNO2 — CID 168507050
1-(5-acetyl-2-bromophenyl)-4-(chloromethyl)pyrrolidin-2-one (PubChem CID 168507050) has the molecular formula C13H13BrClNO2 and a molecular weight of 330.61 g/mol. Its IUPAC name is 1-(5-acetyl-2-bromophenyl)-4-(chloromethyl)pyrrolidin-2-one.
| Compound Name | 1-(5-acetyl-2-bromophenyl)-4-(chloromethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168507050 |
| Molecular Formula | C13H13BrClNO2 |
| Molecular Weight | 330.61 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 1-(5-acetyl-2-bromophenyl)-4-(chloromethyl)pyrrolidin-2-one |
| SMILES | CC(=O)c1ccc(Br)c(N2CC(CCl)CC2=O)c1 |
| InChI | InChI=1S/C13H13BrClNO2/c1-8(17)10-2-3-11(14)12(5-10)16-7-9(6-15)4-13(16)18/h2-3,5,9H,4,6-7H2,1H3 |
| InChIKey | RAZIDCFGCISFIJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|