C11H10Br2ClNO — CID 168508786
4-(chloromethyl)-1-(3,4-dibromophenyl)pyrrolidin-2-one (PubChem CID 168508786) has the molecular formula C11H10Br2ClNO and a molecular weight of 367.47 g/mol. Its IUPAC name is 4-(chloromethyl)-1-(3,4-dibromophenyl)pyrrolidin-2-one.
| Compound Name | 4-(chloromethyl)-1-(3,4-dibromophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168508786 |
| Molecular Formula | C11H10Br2ClNO |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 364.88 |
| IUPAC Name | 4-(chloromethyl)-1-(3,4-dibromophenyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CCl)CN1c1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C11H10Br2ClNO/c12-9-2-1-8(4-10(9)13)15-6-7(5-14)3-11(15)16/h1-2,4,7H,3,5-6H2 |
| InChIKey | FMMQVUXCZDWZNQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|