C10H10Br2N2O3S — CID 168718706
1-(3,4-dibromophenyl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168718706) has the molecular formula C10H10Br2N2O3S and a molecular weight of 398.08 g/mol. Its IUPAC name is 1-(3,4-dibromophenyl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(3,4-dibromophenyl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168718706 |
| Molecular Formula | C10H10Br2N2O3S |
| Molecular Weight | 398.08 g/mol |
| Exact Mass | 395.88 |
| IUPAC Name | 1-(3,4-dibromophenyl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2ccc(Br)c(Br)c2)C1 |
| InChI | InChI=1S/C10H10Br2N2O3S/c11-8-2-1-6(3-9(8)12)14-5-7(4-10(14)15)18(13,16)17/h1-3,7H,4-5H2,(H2,13,16,17) |
| InChIKey | NOJXJKLFXDPAKJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.08 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |