C12H13N3O3S — CID 168717734
1-(3-cyano-4-methylphenyl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168717734) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 1-(3-cyano-4-methylphenyl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(3-cyano-4-methylphenyl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168717734 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 1-(3-cyano-4-methylphenyl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | Cc1ccc(N2CC(S(N)(=O)=O)CC2=O)cc1C#N |
| InChI | InChI=1S/C12H13N3O3S/c1-8-2-3-10(4-9(8)6-13)15-7-11(5-12(15)16)19(14,17)18/h2-4,11H,5,7H2,1H3,(H2,14,17,18) |
| InChIKey | PSSDOJLHPUFLKG-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 104.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |